C15H23N5O2 — CID 110175958
1,3-dimethyl-7-(3-piperidin-1-ylpropyl)purine-2,6-dione (PubChem CID 110175958) has the molecular formula C15H23N5O2 and a molecular weight of 305.38 g/mol. Its IUPAC name is 1,3-dimethyl-7-(3-piperidin-1-ylpropyl)purine-2,6-dione.
| Compound Name | 1,3-dimethyl-7-(3-piperidin-1-ylpropyl)purine-2,6-dione |
|---|---|
| PubChem CID | 110175958 |
| Molecular Formula | C15H23N5O2 |
| Molecular Weight | 305.38 g/mol |
| Exact Mass | 305.19 |
| IUPAC Name | 1,3-dimethyl-7-(3-piperidin-1-ylpropyl)purine-2,6-dione |
| SMILES | Cn1c(=O)c2c(ncn2CCCN2CCCCC2)n(C)c1=O |
| InChI | InChI=1S/C15H23N5O2/c1-17-13-12(14(21)18(2)15(17)22)20(11-16-13)10-6-9-19-7-4-3-5-8-19/h11H,3-10H2,1-2H3 |
| InChIKey | KPKYQKBENRFZHR-UHFFFAOYSA-N |
| XLogP | 0.31 |
| TPSA | 65.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.38 |
| LogP ≤ 5 | 0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |