C18H30BrN5O2 — CID 110175977
1,3-dimethyl-7-[3-(1-propylpiperidin-1-ium-1-yl)propyl]purine-2,6-dione bromide (PubChem CID 110175977) has the molecular formula C18H30BrN5O2 and a molecular weight of 428.38 g/mol. Its IUPAC name is 1,3-dimethyl-7-[3-(1-propylpiperidin-1-ium-1-yl)propyl]purine-2,6-dione bromide.
| Compound Name | 1,3-dimethyl-7-[3-(1-propylpiperidin-1-ium-1-yl)propyl]purine-2,6-dione bromide |
|---|---|
| PubChem CID | 110175977 |
| Molecular Formula | C18H30BrN5O2 |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 427.16 |
| IUPAC Name | 1,3-dimethyl-7-[3-(1-propylpiperidin-1-ium-1-yl)propyl]purine-2,6-dione bromide |
| SMILES | CCC[N+]1(CCCn2cnc3c2c(=O)n(C)c(=O)n3C)CCCCC1.[Br-] |
| InChI | InChI=1S/C18H30N5O2.BrH/c1-4-10-23(11-6-5-7-12-23)13-8-9-22-14-19-16-15(22)17(24)21(3)18(25)20(16)2;/h14H,4-13H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | NMRSQIMKEAQNBX-UHFFFAOYSA-M |
| XLogP | -1.76 |
| TPSA | 61.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|