C20H26N6O4 — CID 3430224
N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]adamantane-1-carbohydrazide (PubChem CID 3430224) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]adamantane-1-carbohydrazide.
| Compound Name | N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]adamantane-1-carbohydrazide |
|---|---|
| PubChem CID | 3430224 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | N'-[2-(1,3-dimethyl-2,6-dioxopurin-7-yl)acetyl]adamantane-1-carbohydrazide |
| SMILES | Cn1c(=O)c2c(ncn2CC(=O)NNC(=O)C23CC4CC(CC(C4)C2)C3)n(C)c1=O |
| InChI | InChI=1S/C20H26N6O4/c1-24-16-15(17(28)25(2)19(24)30)26(10-21-16)9-14(27)22-23-18(29)20-6-11-3-12(7-20)5-13(4-11)8-20/h10-13H,3-9H2,1-2H3,(H,22,27)(H,23,29) |
| InChIKey | TYKHURRTEJRYHO-UHFFFAOYSA-N |
| XLogP | -0.20 |
| TPSA | 120.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | -0.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|