C13H24N2O7 — CID 22839632
[(3R,3aS,6S,6aS)-6-[3-(tert-butylamino)-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate (PubChem CID 22839632) has the molecular formula C13H24N2O7 and a molecular weight of 320.34 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-[3-(tert-butylamino)-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate.
| Compound Name | [(3R,3aS,6S,6aS)-6-[3-(tert-butylamino)-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 22839632 |
| Molecular Formula | C13H24N2O7 |
| Molecular Weight | 320.34 g/mol |
| Exact Mass | 320.16 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-[3-(tert-butylamino)-2-hydroxypropyl]-6-hydroxy-3,3a,5,6a-tetrahydro-2H-furo[3,2-b]furan-3-yl] nitrate |
| SMILES | CC(C)(C)NCC(O)C[C@]1(O)CO[C@@H]2[C@H](O[N+](=O)[O-])CO[C@@H]21 |
| InChI | InChI=1S/C13H24N2O7/c1-12(2,3)14-5-8(16)4-13(17)7-21-10-9(22-15(18)19)6-20-11(10)13/h8-11,14,16-17H,4-7H2,1-3H3/t8?,9-,10-,11+,13+/m1/s1 |
| InChIKey | PQKVPWGPIDOLEM-SRPPKUGISA-N |
| XLogP | -0.77 |
| TPSA | 123.32 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.34 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|