C19H34N2O8 — CID 166838142
tert-butyl N-[5-[[(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,4,4-trimethylpentan-2-yl]carbamate (PubChem CID 166838142) has the molecular formula C19H34N2O8 and a molecular weight of 418.49 g/mol. Its IUPAC name is tert-butyl N-[5-[[(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,4,4-trimethylpentan-2-yl]carbamate.
| Compound Name | tert-butyl N-[5-[[(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,4,4-trimethylpentan-2-yl]carbamate |
|---|---|
| PubChem CID | 166838142 |
| Molecular Formula | C19H34N2O8 |
| Molecular Weight | 418.49 g/mol |
| Exact Mass | 418.23 |
| IUPAC Name | tert-butyl N-[5-[[(3R,3aR,6S,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]oxy]-2,4,4-trimethylpentan-2-yl]carbamate |
| SMILES | CC(C)(CO[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O[N+](=O)[O-])CC(C)(C)NC(=O)OC(C)(C)C |
| InChI | InChI=1S/C19H34N2O8/c1-17(2,3)28-16(22)20-19(6,7)10-18(4,5)11-27-12-8-25-15-13(29-21(23)24)9-26-14(12)15/h12-15H,8-11H2,1-7H3,(H,20,22)/t12-,13+,14-,15-/m1/s1 |
| InChIKey | FQEDDWHYGVAJBM-LXTVHRRPSA-N |
| XLogP | 2.47 |
| TPSA | 118.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.49 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|