C8H10ClNO7 — CID 162514537
[(3S,3aR,6R,6aS)-3-(2-chloro-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 162514537) has the molecular formula C8H10ClNO7 and a molecular weight of 267.62 g/mol. Its IUPAC name is [(3S,3aR,6R,6aS)-3-(2-chloro-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3S,3aR,6R,6aS)-3-(2-chloro-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 162514537 |
| Molecular Formula | C8H10ClNO7 |
| Molecular Weight | 267.62 g/mol |
| Exact Mass | 267.01 |
| IUPAC Name | [(3S,3aR,6R,6aS)-3-(2-chloro-2-oxoethoxy)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | O=C(Cl)CO[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C8H10ClNO7/c9-6(11)3-14-4-1-15-8-5(17-10(12)13)2-16-7(4)8/h4-5,7-8H,1-3H2/t4-,5+,7+,8+/m0/s1 |
| InChIKey | NOKFAHDOBZQJQZ-LRSZDJBLSA-N |
| XLogP | -0.49 |
| TPSA | 97.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.62 |
| LogP ≤ 5 | -0.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|