C6H8N2O8 — CID 13019155
[(3S,3aS,6R,6aR)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 13019155) has the molecular formula C6H8N2O8 and a molecular weight of 236.14 g/mol. Its IUPAC name is [(3S,3aS,6R,6aR)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3S,3aS,6R,6aR)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 13019155 |
| Molecular Formula | C6H8N2O8 |
| Molecular Weight | 236.14 g/mol |
| Exact Mass | 236.03 |
| IUPAC Name | [(3S,3aS,6R,6aR)-3-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | O=[N+]([O-])O[C@H]1CO[C@@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C6H8N2O8/c9-7(10)15-3-1-13-6-4(16-8(11)12)2-14-5(3)6/h3-6H,1-2H2/t3-,4+,5+,6- |
| InChIKey | MOYKHGMNXAOIAT-GUCUJZIJSA-N |
| XLogP | -1.06 |
| TPSA | 123.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.14 |
| LogP ≤ 5 | -1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|