C6H9NO5S3-4 — CID 87461078
[(3R,3aS,6S,6aS)-6-sulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate disulfide (PubChem CID 87461078) has the molecular formula C6H9NO5S3-4 and a molecular weight of 271.34 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-sulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate disulfide.
| Compound Name | [(3R,3aS,6S,6aS)-6-sulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate disulfide |
|---|---|
| PubChem CID | 87461078 |
| Molecular Formula | C6H9NO5S3-4 |
| Molecular Weight | 271.34 g/mol |
| Exact Mass | 270.97 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-sulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate disulfide |
| SMILES | O=[N+]([O-])O[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2S.[S-2].[S-2] |
| InChI | InChI=1S/C6H9NO5S.2S/c8-7(9)12-3-1-10-6-4(13)2-11-5(3)6;;/h3-6,13H,1-2H2;;/q;2*-2/t3-,4+,5-,6-;;/m1../s1 |
| InChIKey | QDAUSUAFKPKINS-MGXNYLRYSA-N |
| XLogP | -0.35 |
| TPSA | 70.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.34 |
| LogP ≤ 5 | -0.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|