C8H12N2O7 — CID 146656376
[(3S,3aR,6aS)-3-[(2-hydroxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 146656376) has the molecular formula C8H12N2O7 and a molecular weight of 248.19 g/mol. Its IUPAC name is [(3S,3aR,6aS)-3-[(2-hydroxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3S,3aR,6aS)-3-[(2-hydroxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 146656376 |
| Molecular Formula | C8H12N2O7 |
| Molecular Weight | 248.19 g/mol |
| Exact Mass | 248.06 |
| IUPAC Name | [(3S,3aR,6aS)-3-[(2-hydroxyacetyl)amino]-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | O=C(CO)N[C@H]1CO[C@@H]2C(O[N+](=O)[O-])CO[C@H]12 |
| InChI | InChI=1S/C8H12N2O7/c11-1-6(12)9-4-2-15-8-5(17-10(13)14)3-16-7(4)8/h4-5,7-8,11H,1-3H2,(H,9,12)/t4-,5?,7+,8+/m0/s1 |
| InChIKey | DTPFMQNJBGEKBG-PUTOIRQPSA-N |
| XLogP | -2.16 |
| TPSA | 120.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.19 |
| LogP ≤ 5 | -2.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|