C12H17N3O9 — CID 146656604
[2-[[2-[[(3S,3aR,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]amino]-2-oxoethyl] acetate (PubChem CID 146656604) has the molecular formula C12H17N3O9 and a molecular weight of 347.28 g/mol. Its IUPAC name is [2-[[2-[[(3S,3aR,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]amino]-2-oxoethyl] acetate.
| Compound Name | [2-[[2-[[(3S,3aR,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]amino]-2-oxoethyl] acetate |
|---|---|
| PubChem CID | 146656604 |
| Molecular Formula | C12H17N3O9 |
| Molecular Weight | 347.28 g/mol |
| Exact Mass | 347.10 |
| IUPAC Name | [2-[[2-[[(3S,3aR,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-2-oxoethyl]amino]-2-oxoethyl] acetate |
| SMILES | CC(=O)OCC(=O)NCC(=O)N[C@H]1CO[C@@H]2C(O[N+](=O)[O-])CO[C@H]12 |
| InChI | InChI=1S/C12H17N3O9/c1-6(16)21-5-10(18)13-2-9(17)14-7-3-22-12-8(24-15(19)20)4-23-11(7)12/h7-8,11-12H,2-5H2,1H3,(H,13,18)(H,14,17)/t7-,8?,11+,12+/m0/s1 |
| InChIKey | XKEQEJWOLOQNKW-IWGDBUMESA-N |
| XLogP | -2.47 |
| TPSA | 155.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.28 |
| LogP ≤ 5 | -2.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|