C10H15N3O7 — CID 158764870
[(3R,3aR,6S,6aS)-3-(2-oxopropylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate (PubChem CID 158764870) has the molecular formula C10H15N3O7 and a molecular weight of 289.24 g/mol. Its IUPAC name is [(3R,3aR,6S,6aS)-3-(2-oxopropylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate.
| Compound Name | [(3R,3aR,6S,6aS)-3-(2-oxopropylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
|---|---|
| PubChem CID | 158764870 |
| Molecular Formula | C10H15N3O7 |
| Molecular Weight | 289.24 g/mol |
| Exact Mass | 289.09 |
| IUPAC Name | [(3R,3aR,6S,6aS)-3-(2-oxopropylcarbamoylamino)-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-6-yl] nitrate |
| SMILES | CC(=O)CNC(=O)N[C@@H]1CO[C@H]2[C@@H]1OC[C@@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C10H15N3O7/c1-5(14)2-11-10(15)12-6-3-18-9-7(20-13(16)17)4-19-8(6)9/h6-9H,2-4H2,1H3,(H2,11,12,15)/t6-,7+,8-,9-/m1/s1 |
| InChIKey | BJYKJAGCJRIQFJ-BZNPZCIMSA-N |
| XLogP | -1.38 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.24 |
| LogP ≤ 5 | -1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|