C17H28N4O9S — CID 10837840
tert-butyl N-[(2R)-1-[[(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3-(acetamidomethylsulfanyl)-1-oxopropan-2-yl]carbamate (PubChem CID 10837840) has the molecular formula C17H28N4O9S and a molecular weight of 464.50 g/mol. Its IUPAC name is tert-butyl N-[(2R)-1-[[(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3-(acetamidomethylsulfanyl)-1-oxopropan-2-yl]carbamate.
| Compound Name | tert-butyl N-[(2R)-1-[[(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3-(acetamidomethylsulfanyl)-1-oxopropan-2-yl]carbamate |
|---|---|
| PubChem CID | 10837840 |
| Molecular Formula | C17H28N4O9S |
| Molecular Weight | 464.50 g/mol |
| Exact Mass | 464.16 |
| IUPAC Name | tert-butyl N-[(2R)-1-[[(3S,3aR,6R,6aS)-6-nitrooxy-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl]amino]-3-(acetamidomethylsulfanyl)-1-oxopropan-2-yl]carbamate |
| SMILES | CC(=O)NCSC[C@H](NC(=O)OC(C)(C)C)C(=O)N[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C17H28N4O9S/c1-9(22)18-8-31-7-11(20-16(24)29-17(2,3)4)15(23)19-10-5-27-14-12(30-21(25)26)6-28-13(10)14/h10-14H,5-8H2,1-4H3,(H,18,22)(H,19,23)(H,20,24)/t10-,11-,12+,13+,14+/m0/s1 |
| InChIKey | UIMWWKQVQFEFBB-ODXJTPSBSA-N |
| XLogP | -0.43 |
| TPSA | 167.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.50 |
| LogP ≤ 5 | -0.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|