C8H13NO5S — CID 45101277
[(3R,3aS,6S,6aS)-6-ethylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 45101277) has the molecular formula C8H13NO5S and a molecular weight of 235.26 g/mol. Its IUPAC name is [(3R,3aS,6S,6aS)-6-ethylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [(3R,3aS,6S,6aS)-6-ethylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 45101277 |
| Molecular Formula | C8H13NO5S |
| Molecular Weight | 235.26 g/mol |
| Exact Mass | 235.05 |
| IUPAC Name | [(3R,3aS,6S,6aS)-6-ethylsulfanyl-2,3,3a,5,6,6a-hexahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | CCS[C@H]1CO[C@H]2[C@@H]1OC[C@H]2O[N+](=O)[O-] |
| InChI | InChI=1S/C8H13NO5S/c1-2-15-6-4-13-7-5(14-9(10)11)3-12-8(6)7/h5-8H,2-4H2,1H3/t5-,6+,7-,8-/m1/s1 |
| InChIKey | TZUIHRQRXAJTKI-ULAWRXDQSA-N |
| XLogP | 0.48 |
| TPSA | 70.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 235.26 |
| LogP ≤ 5 | 0.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|