C13H23N3O7 — CID 72728557
[6-[3-(tert-butylamino)-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate (PubChem CID 72728557) has the molecular formula C13H23N3O7 and a molecular weight of 333.34 g/mol. Its IUPAC name is [6-[3-(tert-butylamino)-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate.
| Compound Name | [6-[3-(tert-butylamino)-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
|---|---|
| PubChem CID | 72728557 |
| Molecular Formula | C13H23N3O7 |
| Molecular Weight | 333.34 g/mol |
| Exact Mass | 333.15 |
| IUPAC Name | [6-[3-(tert-butylamino)-2-hydroxypropoxy]imino-2,3,3a,6a-tetrahydrofuro[3,2-b]furan-3-yl] nitrate |
| SMILES | CC(C)(C)NCC(O)CON=C1COC2C(O[N+](=O)[O-])COC12 |
| InChI | InChI=1S/C13H23N3O7/c1-13(2,3)14-4-8(17)5-22-15-9-6-20-12-10(23-16(18)19)7-21-11(9)12/h8,10-12,14,17H,4-7H2,1-3H3 |
| InChIKey | DSGLUABGLJEZHC-UHFFFAOYSA-N |
| XLogP | -0.52 |
| TPSA | 124.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.34 |
| LogP ≤ 5 | -0.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|