C15H31N3O2 — CID 129437551
(2R)-1-(tert-butylamino)-3-[[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]oxypropan-2-ol (PubChem CID 129437551) has the molecular formula C15H31N3O2 and a molecular weight of 285.43 g/mol. Its IUPAC name is (2R)-1-(tert-butylamino)-3-[[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]oxypropan-2-ol.
| Compound Name | (2R)-1-(tert-butylamino)-3-[[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]oxypropan-2-ol |
|---|---|
| PubChem CID | 129437551 |
| Molecular Formula | C15H31N3O2 |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.24 |
| IUPAC Name | (2R)-1-(tert-butylamino)-3-[[(2R,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino]oxypropan-2-ol |
| SMILES | C[C@@H]1CN(C)[C@H](C)CC1=NOC[C@H](O)CNC(C)(C)C |
| InChI | InChI=1S/C15H31N3O2/c1-11-9-18(6)12(2)7-14(11)17-20-10-13(19)8-16-15(3,4)5/h11-13,16,19H,7-10H2,1-6H3/t11-,12-,13-/m1/s1 |
| InChIKey | AINOWFGVZXPIDC-JHJVBQTASA-N |
| XLogP | 1.47 |
| TPSA | 57.09 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 1.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|