C15H20N2O2 — CID 7065690
[(E)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino] benzoate (PubChem CID 7065690) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [(E)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino] benzoate.
| Compound Name | [(E)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino] benzoate |
|---|---|
| PubChem CID | 7065690 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(E)-[(2S,5R)-1,2,5-trimethylpiperidin-4-ylidene]amino] benzoate |
| SMILES | C[C@@H]1CN(C)[C@@H](C)C/C1=N\OC(=O)c1ccccc1 |
| InChI | InChI=1S/C15H20N2O2/c1-11-10-17(3)12(2)9-14(11)16-19-15(18)13-7-5-4-6-8-13/h4-8,11-12H,9-10H2,1-3H3/b16-14+/t11-,12+/m1/s1 |
| InChIKey | BHUGEYWWNUWAAY-UWLOGMJLSA-N |
| XLogP | 2.56 |
| TPSA | 41.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|