C14H19N3O3 — CID 7427531
(Z,2S,5S)-1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine (PubChem CID 7427531) has the molecular formula C14H19N3O3 and a molecular weight of 277.32 g/mol. Its IUPAC name is (Z,2S,5S)-1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine.
| Compound Name | (Z,2S,5S)-1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine |
|---|---|
| PubChem CID | 7427531 |
| Molecular Formula | C14H19N3O3 |
| Molecular Weight | 277.32 g/mol |
| Exact Mass | 277.14 |
| IUPAC Name | (Z,2S,5S)-1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine |
| SMILES | C[C@H]1CN(C)[C@@H](C)C/C1=N/Oc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C14H19N3O3/c1-10-9-16(3)11(2)8-12(10)15-20-14-7-5-4-6-13(14)17(18)19/h4-7,10-11H,8-9H2,1-3H3/b15-12-/t10-,11-/m0/s1 |
| InChIKey | UQBBTDSGUQJIBT-GTNCLJFYSA-N |
| XLogP | 2.69 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|