C14H19ClN3O3- — CID 53350683
1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine chloride (PubChem CID 53350683) has the molecular formula C14H19ClN3O3- and a molecular weight of 312.78 g/mol. Its IUPAC name is 1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine chloride.
| Compound Name | 1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine chloride |
|---|---|
| PubChem CID | 53350683 |
| Molecular Formula | C14H19ClN3O3- |
| Molecular Weight | 312.78 g/mol |
| Exact Mass | 312.11 |
| IUPAC Name | 1,2,5-trimethyl-N-(2-nitrophenoxy)piperidin-4-imine chloride |
| SMILES | CC1CN(C)C(C)CC1=NOc1ccccc1[N+](=O)[O-].[Cl-] |
| InChI | InChI=1S/C14H19N3O3.ClH/c1-10-9-16(3)11(2)8-12(10)15-20-14-7-5-4-6-13(14)17(18)19;/h4-7,10-11H,8-9H2,1-3H3;1H/p-1 |
| InChIKey | WUVMNRJCJBGSDY-UHFFFAOYSA-M |
| XLogP | -0.31 |
| TPSA | 67.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.78 |
| LogP ≤ 5 | -0.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|