C17H21NO2 — CID 744308
[(2S,4S,5S)-4-ethynyl-1,2,5-trimethylpiperidin-4-yl] benzoate (PubChem CID 744308) has the molecular formula C17H21NO2 and a molecular weight of 271.36 g/mol. Its IUPAC name is [(2S,4S,5S)-4-ethynyl-1,2,5-trimethylpiperidin-4-yl] benzoate.
| Compound Name | [(2S,4S,5S)-4-ethynyl-1,2,5-trimethylpiperidin-4-yl] benzoate |
|---|---|
| PubChem CID | 744308 |
| Molecular Formula | C17H21NO2 |
| Molecular Weight | 271.36 g/mol |
| Exact Mass | 271.16 |
| IUPAC Name | [(2S,4S,5S)-4-ethynyl-1,2,5-trimethylpiperidin-4-yl] benzoate |
| SMILES | C#C[C@]1(OC(=O)c2ccccc2)C[C@H](C)N(C)C[C@@H]1C |
| InChI | InChI=1S/C17H21NO2/c1-5-17(11-14(3)18(4)12-13(17)2)20-16(19)15-9-7-6-8-10-15/h1,6-10,13-14H,11-12H2,2-4H3/t13-,14-,17-/m0/s1 |
| InChIKey | OASDVQSPONGSRY-ZQIUZPCESA-N |
| XLogP | 2.58 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.36 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|