About (1-methylcyclopropyl) benzoate
(1-methylcyclopropyl) benzoate (PubChem CID 14416714) has the molecular formula C11H12O2
and a molecular weight of 176.22 g/mol. Its IUPAC name is (1-methylcyclopropyl) benzoate.
Molecular Properties
| Compound Name | (1-methylcyclopropyl) benzoate |
| PubChem CID | 14416714 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | (1-methylcyclopropyl) benzoate |
| SMILES | CC1(OC(=O)c2ccccc2)CC1 |
| InChI | InChI=1S/C11H12O2/c1-11(7-8-11)13-10(12)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3 |
| InChIKey | GRIOVNKAIYROPL-UHFFFAOYSA-N |
| XLogP | 2.40 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze (1-methylcyclopropyl) benzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-methylcyclopropyl) benzoate?
The IUPAC name of (1-methylcyclopropyl) benzoate (CID 14416714) is (1-methylcyclopropyl) benzoate.
What is the SMILES notation for (1-methylcyclopropyl) benzoate?
The canonical SMILES for (1-methylcyclopropyl) benzoate is CC1(OC(=O)c2ccccc2)CC1.
What is the InChIKey of (1-methylcyclopropyl) benzoate?
The InChIKey is GRIOVNKAIYROPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H12O2/c1-11(7-8-11)13-10(12)9-5-3-2-4-6-9/h2-6H,7-8H2,1H3.
What are the key properties of (1-methylcyclopropyl) benzoate?
(1-methylcyclopropyl) benzoate has a molecular weight of 176.22 g/mol, XLogP of 2.40, 2 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (1-methylcyclopropyl) benzoate is sourced from PubChem (CID 14416714), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).