C20H26O2 — CID 70476402
(2,5,5-trimethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl) benzoate (PubChem CID 70476402) has the molecular formula C20H26O2 and a molecular weight of 298.43 g/mol. Its IUPAC name is (2,5,5-trimethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl) benzoate.
| Compound Name | (2,5,5-trimethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl) benzoate |
|---|---|
| PubChem CID | 70476402 |
| Molecular Formula | C20H26O2 |
| Molecular Weight | 298.43 g/mol |
| Exact Mass | 298.19 |
| IUPAC Name | (2,5,5-trimethyl-1,3,4,4a,6,7-hexahydronaphthalen-2-yl) benzoate |
| SMILES | CC1(OC(=O)c2ccccc2)CCC2C(=CCCC2(C)C)C1 |
| InChI | InChI=1S/C20H26O2/c1-19(2)12-7-10-16-14-20(3,13-11-17(16)19)22-18(21)15-8-5-4-6-9-15/h4-6,8-10,17H,7,11-14H2,1-3H3 |
| InChIKey | OTSVSIWGYVYOGI-UHFFFAOYSA-N |
| XLogP | 5.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.43 |
| LogP ≤ 5 | 5.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|