C17H21O2PS — CID 23265401
[(1S,2R,4S,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate (PubChem CID 23265401) has the molecular formula C17H21O2PS and a molecular weight of 320.39 g/mol. Its IUPAC name is [(1S,2R,4S,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate.
| Compound Name | [(1S,2R,4S,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate |
|---|---|
| PubChem CID | 23265401 |
| Molecular Formula | C17H21O2PS |
| Molecular Weight | 320.39 g/mol |
| Exact Mass | 320.10 |
| IUPAC Name | [(1S,2R,4S,5R)-4-ethynyl-2,5-dimethyl-1-phenyl-1-sulfanylidene-1λ5-phosphinan-4-yl] acetate |
| SMILES | C#C[C@]1(OC(C)=O)C[C@@H](C)[P@](=S)(c2ccccc2)C[C@@H]1C |
| InChI | InChI=1S/C17H21O2PS/c1-5-17(19-15(4)18)11-14(3)20(21,12-13(17)2)16-9-7-6-8-10-16/h1,6-10,13-14H,11-12H2,2-4H3/t13-,14+,17-,20-/m0/s1 |
| InChIKey | NARDARDBIKPLKD-ACNBBOPNSA-N |
| XLogP | 3.15 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.39 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|