About (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate
(2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate (PubChem CID 175365276) has the molecular formula C14H13F2NO2
and a molecular weight of 265.26 g/mol. Its IUPAC name is (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate.
Molecular Properties
| Compound Name | (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate |
| PubChem CID | 175365276 |
| Molecular Formula | C14H13F2NO2 |
| Molecular Weight | 265.26 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate |
| SMILES | C#CC1(OC(N)=O)CC(F)(F)C1Cc1ccccc1 |
| InChI | InChI=1S/C14H13F2NO2/c1-2-13(19-12(17)18)9-14(15,16)11(13)8-10-6-4-3-5-7-10/h1,3-7,11H,8-9H2,(H2,17,18) |
| InChIKey | SYFZDSNACDPMOJ-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 52.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.26 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate?
The IUPAC name of (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate (CID 175365276) is (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate.
What is the SMILES notation for (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate?
The canonical SMILES for (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate is C#CC1(OC(N)=O)CC(F)(F)C1Cc1ccccc1.
What is the InChIKey of (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate?
The InChIKey is SYFZDSNACDPMOJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H13F2NO2/c1-2-13(19-12(17)18)9-14(15,16)11(13)8-10-6-4-3-5-7-10/h1,3-7,11H,8-9H2,(H2,17,18).
What are the key properties of (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate?
(2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate has a molecular weight of 265.26 g/mol, XLogP of 2.35, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2-benzyl-1-ethynyl-3,3-difluorocyclobutyl) carbamate is sourced from PubChem (CID 175365276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).