C14H18FNO3 — CID 172849870
[(1R,3S,4S)-1-benzyl-3-fluoro-4-hydroxycyclohexyl] carbamate (PubChem CID 172849870) has the molecular formula C14H18FNO3 and a molecular weight of 267.30 g/mol. Its IUPAC name is [(1R,3S,4S)-1-benzyl-3-fluoro-4-hydroxycyclohexyl] carbamate.
| Compound Name | [(1R,3S,4S)-1-benzyl-3-fluoro-4-hydroxycyclohexyl] carbamate |
|---|---|
| PubChem CID | 172849870 |
| Molecular Formula | C14H18FNO3 |
| Molecular Weight | 267.30 g/mol |
| Exact Mass | 267.13 |
| IUPAC Name | [(1R,3S,4S)-1-benzyl-3-fluoro-4-hydroxycyclohexyl] carbamate |
| SMILES | NC(=O)O[C@@]1(Cc2ccccc2)CC[C@H](O)[C@@H](F)C1 |
| InChI | InChI=1S/C14H18FNO3/c15-11-9-14(19-13(16)18,7-6-12(11)17)8-10-4-2-1-3-5-10/h1-5,11-12,17H,6-9H2,(H2,16,18)/t11-,12-,14+/m0/s1 |
| InChIKey | XXPQGMCASGTLTE-SGMGOOAPSA-N |
| XLogP | 1.95 |
| TPSA | 72.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.30 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |