C15H20N2O2 — CID 172844272
[(1R,2R,5S)-1-benzyl-8-azabicyclo[3.2.1]octan-2-yl] carbamate (PubChem CID 172844272) has the molecular formula C15H20N2O2 and a molecular weight of 260.34 g/mol. Its IUPAC name is [(1R,2R,5S)-1-benzyl-8-azabicyclo[3.2.1]octan-2-yl] carbamate.
| Compound Name | [(1R,2R,5S)-1-benzyl-8-azabicyclo[3.2.1]octan-2-yl] carbamate |
|---|---|
| PubChem CID | 172844272 |
| Molecular Formula | C15H20N2O2 |
| Molecular Weight | 260.34 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | [(1R,2R,5S)-1-benzyl-8-azabicyclo[3.2.1]octan-2-yl] carbamate |
| SMILES | NC(=O)O[C@@H]1CC[C@@H]2CC[C@]1(Cc1ccccc1)N2 |
| InChI | InChI=1S/C15H20N2O2/c16-14(18)19-13-7-6-12-8-9-15(13,17-12)10-11-4-2-1-3-5-11/h1-5,12-13,17H,6-10H2,(H2,16,18)/t12-,13-,15-/m1/s1 |
| InChIKey | XFAJUUYGFUKATH-UMVBOHGHSA-N |
| XLogP | 1.98 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.34 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |