C29H35NO7 — CID 11071259
diethyl 2-[(2S)-1-benzoyl-5-benzyl-5-ethoxycarbonylpyrrolidin-2-yl]-2-methylpropanedioate (PubChem CID 11071259) has the molecular formula C29H35NO7 and a molecular weight of 509.60 g/mol. Its IUPAC name is diethyl 2-[(2S)-1-benzoyl-5-benzyl-5-ethoxycarbonylpyrrolidin-2-yl]-2-methylpropanedioate.
| Compound Name | diethyl 2-[(2S)-1-benzoyl-5-benzyl-5-ethoxycarbonylpyrrolidin-2-yl]-2-methylpropanedioate |
|---|---|
| PubChem CID | 11071259 |
| Molecular Formula | C29H35NO7 |
| Molecular Weight | 509.60 g/mol |
| Exact Mass | 509.24 |
| IUPAC Name | diethyl 2-[(2S)-1-benzoyl-5-benzyl-5-ethoxycarbonylpyrrolidin-2-yl]-2-methylpropanedioate |
| SMILES | CCOC(=O)C(C)(C(=O)OCC)[C@@H]1CCC(Cc2ccccc2)(C(=O)OCC)N1C(=O)c1ccccc1 |
| InChI | InChI=1S/C29H35NO7/c1-5-35-25(32)28(4,26(33)36-6-2)23-18-19-29(27(34)37-7-3,20-21-14-10-8-11-15-21)30(23)24(31)22-16-12-9-13-17-22/h8-17,23H,5-7,18-20H2,1-4H3/t23-,29?/m0/s1 |
| InChIKey | FZEFSMYTAFGJCC-QASNXKAYSA-N |
| XLogP | 3.97 |
| TPSA | 99.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.60 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|