C15H16BrNO3 — CID 139114881
methyl (1S,2S,4S)-7-benzoyl-4-bromo-7-azabicyclo[2.2.1]heptane-2-carboxylate (PubChem CID 139114881) has the molecular formula C15H16BrNO3 and a molecular weight of 338.20 g/mol. Its IUPAC name is methyl (1S,2S,4S)-7-benzoyl-4-bromo-7-azabicyclo[2.2.1]heptane-2-carboxylate.
| Compound Name | methyl (1S,2S,4S)-7-benzoyl-4-bromo-7-azabicyclo[2.2.1]heptane-2-carboxylate |
|---|---|
| PubChem CID | 139114881 |
| Molecular Formula | C15H16BrNO3 |
| Molecular Weight | 338.20 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | methyl (1S,2S,4S)-7-benzoyl-4-bromo-7-azabicyclo[2.2.1]heptane-2-carboxylate |
| SMILES | COC(=O)[C@H]1C[C@@]2(Br)CC[C@@H]1N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C15H16BrNO3/c1-20-14(19)11-9-15(16)8-7-12(11)17(15)13(18)10-5-3-2-4-6-10/h2-6,11-12H,7-9H2,1H3/t11-,12-,15+/m0/s1 |
| InChIKey | FXNUJALQFHRAHB-SLEUVZQESA-N |
| XLogP | 2.58 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.20 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'} |
|---|