C22H23NO3 — CID 15758871
methyl 8-benzoyl-3-phenyl-8-azabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 15758871) has the molecular formula C22H23NO3 and a molecular weight of 349.43 g/mol. Its IUPAC name is methyl 8-benzoyl-3-phenyl-8-azabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl 8-benzoyl-3-phenyl-8-azabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 15758871 |
| Molecular Formula | C22H23NO3 |
| Molecular Weight | 349.43 g/mol |
| Exact Mass | 349.17 |
| IUPAC Name | methyl 8-benzoyl-3-phenyl-8-azabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COC(=O)C12CCC(CC(c3ccccc3)C1)N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H23NO3/c1-26-21(25)22-13-12-19(14-18(15-22)16-8-4-2-5-9-16)23(22)20(24)17-10-6-3-7-11-17/h2-11,18-19H,12-15H2,1H3 |
| InChIKey | YGGJSFQZNSHPQD-UHFFFAOYSA-N |
| XLogP | 3.78 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.43 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |