C16H17NO3 — CID 10635822
methyl (1R,4S)-7-benzoyl-3-methylidene-7-azabicyclo[2.2.1]heptane-1-carboxylate (PubChem CID 10635822) has the molecular formula C16H17NO3 and a molecular weight of 271.32 g/mol. Its IUPAC name is methyl (1R,4S)-7-benzoyl-3-methylidene-7-azabicyclo[2.2.1]heptane-1-carboxylate.
| Compound Name | methyl (1R,4S)-7-benzoyl-3-methylidene-7-azabicyclo[2.2.1]heptane-1-carboxylate |
|---|---|
| PubChem CID | 10635822 |
| Molecular Formula | C16H17NO3 |
| Molecular Weight | 271.32 g/mol |
| Exact Mass | 271.12 |
| IUPAC Name | methyl (1R,4S)-7-benzoyl-3-methylidene-7-azabicyclo[2.2.1]heptane-1-carboxylate |
| SMILES | C=C1C[C@@]2(C(=O)OC)CC[C@@H]1N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C16H17NO3/c1-11-10-16(15(19)20-2)9-8-13(11)17(16)14(18)12-6-4-3-5-7-12/h3-7,13H,1,8-10H2,2H3/t13-,16+/m0/s1 |
| InChIKey | IUFABROVAFKZPU-XJKSGUPXSA-N |
| XLogP | 2.16 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.32 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|