C22H33NO4Si — CID 10069759
methyl (1S,5R,6S)-8-benzoyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octane-1-carboxylate (PubChem CID 10069759) has the molecular formula C22H33NO4Si and a molecular weight of 403.60 g/mol. Its IUPAC name is methyl (1S,5R,6S)-8-benzoyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octane-1-carboxylate.
| Compound Name | methyl (1S,5R,6S)-8-benzoyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octane-1-carboxylate |
|---|---|
| PubChem CID | 10069759 |
| Molecular Formula | C22H33NO4Si |
| Molecular Weight | 403.60 g/mol |
| Exact Mass | 403.22 |
| IUPAC Name | methyl (1S,5R,6S)-8-benzoyl-6-[tert-butyl(dimethyl)silyl]oxy-8-azabicyclo[3.2.1]octane-1-carboxylate |
| SMILES | COC(=O)[C@]12CCC[C@H]([C@@H](O[Si](C)(C)C(C)(C)C)C1)N2C(=O)c1ccccc1 |
| InChI | InChI=1S/C22H33NO4Si/c1-21(2,3)28(5,6)27-18-15-22(20(25)26-4)14-10-13-17(18)23(22)19(24)16-11-8-7-9-12-16/h7-9,11-12,17-18H,10,13-15H2,1-6H3/t17-,18+,22+/m1/s1 |
| InChIKey | AIPPBGQLWQHMKG-FGSXEWAUSA-N |
| XLogP | 4.39 |
| TPSA | 55.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.60 |
| LogP ≤ 5 | 4.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|