C23H39NO3Si — CID 174069006
methyl (3S)-1-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylazepane-3-carboxylate (PubChem CID 174069006) has the molecular formula C23H39NO3Si and a molecular weight of 405.66 g/mol. Its IUPAC name is methyl (3S)-1-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylazepane-3-carboxylate.
| Compound Name | methyl (3S)-1-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylazepane-3-carboxylate |
|---|---|
| PubChem CID | 174069006 |
| Molecular Formula | C23H39NO3Si |
| Molecular Weight | 405.66 g/mol |
| Exact Mass | 405.27 |
| IUPAC Name | methyl (3S)-1-benzyl-6-[tert-butyl(dimethyl)silyl]oxy-2,5-dimethylazepane-3-carboxylate |
| SMILES | COC(=O)[C@H]1CC(C)C(O[Si](C)(C)C(C)(C)C)CN(Cc2ccccc2)C1C |
| InChI | InChI=1S/C23H39NO3Si/c1-17-14-20(22(25)26-6)18(2)24(15-19-12-10-9-11-13-19)16-21(17)27-28(7,8)23(3,4)5/h9-13,17-18,20-21H,14-16H2,1-8H3/t17?,18?,20-,21?/m0/s1 |
| InChIKey | XPVZGXHALLLMDX-MFLJXGGJSA-N |
| XLogP | 5.10 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.66 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|