C22H37NO3Si — CID 69172773
methyl 1-benzyl-4-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyrrolidine-3-carboxylate (PubChem CID 69172773) has the molecular formula C22H37NO3Si and a molecular weight of 391.63 g/mol. Its IUPAC name is methyl 1-benzyl-4-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyrrolidine-3-carboxylate.
| Compound Name | methyl 1-benzyl-4-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 69172773 |
| Molecular Formula | C22H37NO3Si |
| Molecular Weight | 391.63 g/mol |
| Exact Mass | 391.25 |
| IUPAC Name | methyl 1-benzyl-4-[1-[tert-butyl(dimethyl)silyl]oxypropan-2-yl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)C1CN(Cc2ccccc2)CC1C(C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C22H37NO3Si/c1-17(16-26-27(6,7)22(2,3)4)19-14-23(15-20(19)21(24)25-5)13-18-11-9-8-10-12-18/h8-12,17,19-20H,13-16H2,1-7H3 |
| InChIKey | KVNGYOPIABOXCW-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.63 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|