C29H42FN3O3Si — CID 99768760
methyl (3S,4R)-1-benzyl-4-[6-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]pyrrolidine-3-carboxylate (PubChem CID 99768760) has the molecular formula C29H42FN3O3Si and a molecular weight of 527.76 g/mol. Its IUPAC name is methyl (3S,4R)-1-benzyl-4-[6-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]pyrrolidine-3-carboxylate.
| Compound Name | methyl (3S,4R)-1-benzyl-4-[6-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]pyrrolidine-3-carboxylate |
|---|---|
| PubChem CID | 99768760 |
| Molecular Formula | C29H42FN3O3Si |
| Molecular Weight | 527.76 g/mol |
| Exact Mass | 527.30 |
| IUPAC Name | methyl (3S,4R)-1-benzyl-4-[6-[(3R)-3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]pyrrolidine-3-carboxylate |
| SMILES | COC(=O)[C@@H]1CN(Cc2ccccc2)C[C@H]1c1ccc(N2CC[C@@H](CO[Si](C)(C)C(C)(C)C)C2)nc1F |
| InChI | InChI=1S/C29H42FN3O3Si/c1-29(2,3)37(5,6)36-20-22-14-15-33(17-22)26-13-12-23(27(30)31-26)24-18-32(19-25(24)28(34)35-4)16-21-10-8-7-9-11-21/h7-13,22,24-25H,14-20H2,1-6H3/t22-,24+,25-/m1/s1 |
| InChIKey | POKUJHAYXYKFDA-PZUNEJSGSA-N |
| XLogP | 5.46 |
| TPSA | 54.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.76 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|