C18H31N3O3Si — CID 174107198
[6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]-3-pyridinyl]carbamic acid (PubChem CID 174107198) has the molecular formula C18H31N3O3Si and a molecular weight of 365.55 g/mol. Its IUPAC name is [6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]-3-pyridinyl]carbamic acid.
| Compound Name | [6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]-3-pyridinyl]carbamic acid |
|---|---|
| PubChem CID | 174107198 |
| Molecular Formula | C18H31N3O3Si |
| Molecular Weight | 365.55 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | [6-[4-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]-3-pyridinyl]carbamic acid |
| SMILES | CC(C)(C)[Si](C)(C)OCC1CCN(c2ccc(NC(=O)O)cn2)CC1 |
| InChI | InChI=1S/C18H31N3O3Si/c1-18(2,3)25(4,5)24-13-14-8-10-21(11-9-14)16-7-6-15(12-19-16)20-17(22)23/h6-7,12,14,20H,8-11,13H2,1-5H3,(H,22,23) |
| InChIKey | ODONMTMYWLPHTA-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 74.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.55 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|