C17H30N2O2Si — CID 86730059
1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]piperidin-4-ol (PubChem CID 86730059) has the molecular formula C17H30N2O2Si and a molecular weight of 322.53 g/mol. Its IUPAC name is 1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]piperidin-4-ol.
| Compound Name | 1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]piperidin-4-ol |
|---|---|
| PubChem CID | 86730059 |
| Molecular Formula | C17H30N2O2Si |
| Molecular Weight | 322.53 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | 1-[5-[[tert-butyl(dimethyl)silyl]oxymethyl]-2-pyridinyl]piperidin-4-ol |
| SMILES | CC(C)(C)[Si](C)(C)OCc1ccc(N2CCC(O)CC2)nc1 |
| InChI | InChI=1S/C17H30N2O2Si/c1-17(2,3)22(4,5)21-13-14-6-7-16(18-12-14)19-10-8-15(20)9-11-19/h6-7,12,15,20H,8-11,13H2,1-5H3 |
| InChIKey | OVRPPAVNVCRFIK-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 45.59 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.53 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|