C21H36FN3O3Si — CID 46318074
tert-butyl N-[6-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]carbamate (PubChem CID 46318074) has the molecular formula C21H36FN3O3Si and a molecular weight of 425.62 g/mol. Its IUPAC name is tert-butyl N-[6-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]carbamate.
| Compound Name | tert-butyl N-[6-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]carbamate |
|---|---|
| PubChem CID | 46318074 |
| Molecular Formula | C21H36FN3O3Si |
| Molecular Weight | 425.62 g/mol |
| Exact Mass | 425.25 |
| IUPAC Name | tert-butyl N-[6-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]pyrrolidin-1-yl]-2-fluoro-3-pyridinyl]carbamate |
| SMILES | CC(C)(C)OC(=O)Nc1ccc(N2CCC(CO[Si](C)(C)C(C)(C)C)C2)nc1F |
| InChI | InChI=1S/C21H36FN3O3Si/c1-20(2,3)28-19(26)23-16-9-10-17(24-18(16)22)25-12-11-15(13-25)14-27-29(7,8)21(4,5)6/h9-10,15H,11-14H2,1-8H3,(H,23,26) |
| InChIKey | RTVWDCOOJGQFTE-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 63.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.62 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|