C22H35NO3Si — CID 76569225
methyl 3-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]phenyl]prop-2-enoate (PubChem CID 76569225) has the molecular formula C22H35NO3Si and a molecular weight of 389.61 g/mol. Its IUPAC name is methyl 3-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]phenyl]prop-2-enoate.
| Compound Name | methyl 3-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 76569225 |
| Molecular Formula | C22H35NO3Si |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.24 |
| IUPAC Name | methyl 3-[2-[3-[[tert-butyl(dimethyl)silyl]oxymethyl]piperidin-1-yl]phenyl]prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccccc1N1CCCC(CO[Si](C)(C)C(C)(C)C)C1 |
| InChI | InChI=1S/C22H35NO3Si/c1-22(2,3)27(5,6)26-17-18-10-9-15-23(16-18)20-12-8-7-11-19(20)13-14-21(24)25-4/h7-8,11-14,18H,9-10,15-17H2,1-6H3 |
| InChIKey | CXEQEFKFHJBDNF-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|