C15H19NO2 — CID 169479575
methyl 3-(2-piperidin-1-ylphenyl)prop-2-enoate (PubChem CID 169479575) has the molecular formula C15H19NO2 and a molecular weight of 245.32 g/mol. Its IUPAC name is methyl 3-(2-piperidin-1-ylphenyl)prop-2-enoate.
| Compound Name | methyl 3-(2-piperidin-1-ylphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 169479575 |
| Molecular Formula | C15H19NO2 |
| Molecular Weight | 245.32 g/mol |
| Exact Mass | 245.14 |
| IUPAC Name | methyl 3-(2-piperidin-1-ylphenyl)prop-2-enoate |
| SMILES | COC(=O)C=Cc1ccccc1N1CCCCC1 |
| InChI | InChI=1S/C15H19NO2/c1-18-15(17)10-9-13-7-3-4-8-14(13)16-11-5-2-6-12-16/h3-4,7-10H,2,5-6,11-12H2,1H3 |
| InChIKey | VOBBFHAUPCYTDE-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 245.32 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|