C16H18N2O4 — CID 132584109
methyl (E)-3-[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)phenyl]prop-2-enoate (PubChem CID 132584109) has the molecular formula C16H18N2O4 and a molecular weight of 302.33 g/mol. Its IUPAC name is methyl (E)-3-[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)phenyl]prop-2-enoate.
| Compound Name | methyl (E)-3-[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)phenyl]prop-2-enoate |
|---|---|
| PubChem CID | 132584109 |
| Molecular Formula | C16H18N2O4 |
| Molecular Weight | 302.33 g/mol |
| Exact Mass | 302.13 |
| IUPAC Name | methyl (E)-3-[2-(2,5-dioxo-4-propan-2-ylimidazolidin-1-yl)phenyl]prop-2-enoate |
| SMILES | COC(=O)/C=C/c1ccccc1N1C(=O)NC(C(C)C)C1=O |
| InChI | InChI=1S/C16H18N2O4/c1-10(2)14-15(20)18(16(21)17-14)12-7-5-4-6-11(12)8-9-13(19)22-3/h4-10,14H,1-3H3,(H,17,21)/b9-8+ |
| InChIKey | YFEXJSBDYICFDS-CMDGGOBGSA-N |
| XLogP | 1.95 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.33 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|