C18H29N3O2 — CID 89272020
tert-butyl N-[2-[1-(2-aminophenyl)piperidin-3-yl]ethyl]carbamate (PubChem CID 89272020) has the molecular formula C18H29N3O2 and a molecular weight of 319.45 g/mol. Its IUPAC name is tert-butyl N-[2-[1-(2-aminophenyl)piperidin-3-yl]ethyl]carbamate.
| Compound Name | tert-butyl N-[2-[1-(2-aminophenyl)piperidin-3-yl]ethyl]carbamate |
|---|---|
| PubChem CID | 89272020 |
| Molecular Formula | C18H29N3O2 |
| Molecular Weight | 319.45 g/mol |
| Exact Mass | 319.23 |
| IUPAC Name | tert-butyl N-[2-[1-(2-aminophenyl)piperidin-3-yl]ethyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NCCC1CCCN(c2ccccc2N)C1 |
| InChI | InChI=1S/C18H29N3O2/c1-18(2,3)23-17(22)20-11-10-14-7-6-12-21(13-14)16-9-5-4-8-15(16)19/h4-5,8-9,14H,6-7,10-13,19H2,1-3H3,(H,20,22) |
| InChIKey | NMVWHCVYUQTOKS-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 67.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.45 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|