C23H30N4O3 — CID 174754982
tert-butyl N-[[1-(2-amino-4-benzoylphenyl)piperidin-3-yl]amino]carbamate (PubChem CID 174754982) has the molecular formula C23H30N4O3 and a molecular weight of 410.52 g/mol. Its IUPAC name is tert-butyl N-[[1-(2-amino-4-benzoylphenyl)piperidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[1-(2-amino-4-benzoylphenyl)piperidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 174754982 |
| Molecular Formula | C23H30N4O3 |
| Molecular Weight | 410.52 g/mol |
| Exact Mass | 410.23 |
| IUPAC Name | tert-butyl N-[[1-(2-amino-4-benzoylphenyl)piperidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1CCCN(c2ccc(C(=O)c3ccccc3)cc2N)C1 |
| InChI | InChI=1S/C23H30N4O3/c1-23(2,3)30-22(29)26-25-18-10-7-13-27(15-18)20-12-11-17(14-19(20)24)21(28)16-8-5-4-6-9-16/h4-6,8-9,11-12,14,18,25H,7,10,13,15,24H2,1-3H3,(H,26,29) |
| InChIKey | PIGILLDBIOPPMI-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.52 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|