C20H28N4O5 — CID 175263698
tert-butyl N-[[1-[4-(cyclopropanecarbonyl)-2-nitrophenyl]piperidin-3-yl]amino]carbamate (PubChem CID 175263698) has the molecular formula C20H28N4O5 and a molecular weight of 404.47 g/mol. Its IUPAC name is tert-butyl N-[[1-[4-(cyclopropanecarbonyl)-2-nitrophenyl]piperidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[1-[4-(cyclopropanecarbonyl)-2-nitrophenyl]piperidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 175263698 |
| Molecular Formula | C20H28N4O5 |
| Molecular Weight | 404.47 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | tert-butyl N-[[1-[4-(cyclopropanecarbonyl)-2-nitrophenyl]piperidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1CCCN(c2ccc(C(=O)C3CC3)cc2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C20H28N4O5/c1-20(2,3)29-19(26)22-21-15-5-4-10-23(12-15)16-9-8-14(11-17(16)24(27)28)18(25)13-6-7-13/h8-9,11,13,15,21H,4-7,10,12H2,1-3H3,(H,22,26) |
| InChIKey | ZRBGJIKKXFDKSH-UHFFFAOYSA-N |
| XLogP | 3.19 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.47 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|