C16H23FN4O4 — CID 174633578
tert-butyl N-[[1-(3-fluoro-2-nitrophenyl)piperidin-3-yl]amino]carbamate (PubChem CID 174633578) has the molecular formula C16H23FN4O4 and a molecular weight of 354.38 g/mol. Its IUPAC name is tert-butyl N-[[1-(3-fluoro-2-nitrophenyl)piperidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[1-(3-fluoro-2-nitrophenyl)piperidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 174633578 |
| Molecular Formula | C16H23FN4O4 |
| Molecular Weight | 354.38 g/mol |
| Exact Mass | 354.17 |
| IUPAC Name | tert-butyl N-[[1-(3-fluoro-2-nitrophenyl)piperidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NNC1CCCN(c2cccc(F)c2[N+](=O)[O-])C1 |
| InChI | InChI=1S/C16H23FN4O4/c1-16(2,3)25-15(22)19-18-11-6-5-9-20(10-11)13-8-4-7-12(17)14(13)21(23)24/h4,7-8,11,18H,5-6,9-10H2,1-3H3,(H,19,22) |
| InChIKey | CQPBVUKBYMAKEF-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 96.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.38 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|