C16H23ClN4O4 — CID 86673552
tert-butyl N-[(3R)-1-(2-chloro-6-methyl-3-nitro-4-pyridinyl)piperidin-3-yl]carbamate (PubChem CID 86673552) has the molecular formula C16H23ClN4O4 and a molecular weight of 370.84 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-(2-chloro-6-methyl-3-nitro-4-pyridinyl)piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-(2-chloro-6-methyl-3-nitro-4-pyridinyl)piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 86673552 |
| Molecular Formula | C16H23ClN4O4 |
| Molecular Weight | 370.84 g/mol |
| Exact Mass | 370.14 |
| IUPAC Name | tert-butyl N-[(3R)-1-(2-chloro-6-methyl-3-nitro-4-pyridinyl)piperidin-3-yl]carbamate |
| SMILES | Cc1cc(N2CCC[C@@H](NC(=O)OC(C)(C)C)C2)c([N+](=O)[O-])c(Cl)n1 |
| InChI | InChI=1S/C16H23ClN4O4/c1-10-8-12(13(21(23)24)14(17)18-10)20-7-5-6-11(9-20)19-15(22)25-16(2,3)4/h8,11H,5-7,9H2,1-4H3,(H,19,22)/t11-/m1/s1 |
| InChIKey | LKXQWWAYSXLEBV-LLVKDONJSA-N |
| XLogP | 3.45 |
| TPSA | 97.60 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.84 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|