C21H23FN4O5 — CID 174476316
tert-butyl N-[[(3S)-1-(2-fluoro-3-nitro-4-phenylphenyl)-2-oxopyrrolidin-3-yl]amino]carbamate (PubChem CID 174476316) has the molecular formula C21H23FN4O5 and a molecular weight of 430.44 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-1-(2-fluoro-3-nitro-4-phenylphenyl)-2-oxopyrrolidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3S)-1-(2-fluoro-3-nitro-4-phenylphenyl)-2-oxopyrrolidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 174476316 |
| Molecular Formula | C21H23FN4O5 |
| Molecular Weight | 430.44 g/mol |
| Exact Mass | 430.17 |
| IUPAC Name | tert-butyl N-[[(3S)-1-(2-fluoro-3-nitro-4-phenylphenyl)-2-oxopyrrolidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@H]1CCN(c2ccc(-c3ccccc3)c([N+](=O)[O-])c2F)C1=O |
| InChI | InChI=1S/C21H23FN4O5/c1-21(2,3)31-20(28)24-23-15-11-12-25(19(15)27)16-10-9-14(13-7-5-4-6-8-13)18(17(16)22)26(29)30/h4-10,15,23H,11-12H2,1-3H3,(H,24,28)/t15-/m0/s1 |
| InChIKey | UGKUAYHGDVFAET-HNNXBMFYSA-N |
| XLogP | 3.54 |
| TPSA | 113.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.44 |
| LogP ≤ 5 | 3.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|