C26H28N2O4 — CID 90736393
tert-butyl N-[(3R)-2-oxo-1-(7-phenylmethoxynaphthalen-1-yl)pyrrolidin-3-yl]carbamate (PubChem CID 90736393) has the molecular formula C26H28N2O4 and a molecular weight of 432.52 g/mol. Its IUPAC name is tert-butyl N-[(3R)-2-oxo-1-(7-phenylmethoxynaphthalen-1-yl)pyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-2-oxo-1-(7-phenylmethoxynaphthalen-1-yl)pyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 90736393 |
| Molecular Formula | C26H28N2O4 |
| Molecular Weight | 432.52 g/mol |
| Exact Mass | 432.20 |
| IUPAC Name | tert-butyl N-[(3R)-2-oxo-1-(7-phenylmethoxynaphthalen-1-yl)pyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2cccc3ccc(OCc4ccccc4)cc23)C1=O |
| InChI | InChI=1S/C26H28N2O4/c1-26(2,3)32-25(30)27-22-14-15-28(24(22)29)23-11-7-10-19-12-13-20(16-21(19)23)31-17-18-8-5-4-6-9-18/h4-13,16,22H,14-15,17H2,1-3H3,(H,27,30)/t22-/m1/s1 |
| InChIKey | KHORGYFNLFOJTL-JOCHJYFZSA-N |
| XLogP | 5.05 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.52 |
| LogP ≤ 5 | 5.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |