C25H35BrN2O4Si — CID 70171856
tert-butyl N-[(3R)-1-[2-bromo-7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-2-oxopyrrolidin-3-yl]carbamate (PubChem CID 70171856) has the molecular formula C25H35BrN2O4Si and a molecular weight of 535.56 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[2-bromo-7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-2-oxopyrrolidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[2-bromo-7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-2-oxopyrrolidin-3-yl]carbamate |
|---|---|
| PubChem CID | 70171856 |
| Molecular Formula | C25H35BrN2O4Si |
| Molecular Weight | 535.56 g/mol |
| Exact Mass | 534.15 |
| IUPAC Name | tert-butyl N-[(3R)-1-[2-bromo-7-[tert-butyl(dimethyl)silyl]oxynaphthalen-1-yl]-2-oxopyrrolidin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1CCN(c2c(Br)ccc3ccc(O[Si](C)(C)C(C)(C)C)cc23)C1=O |
| InChI | InChI=1S/C25H35BrN2O4Si/c1-24(2,3)31-23(30)27-20-13-14-28(22(20)29)21-18-15-17(32-33(7,8)25(4,5)6)11-9-16(18)10-12-19(21)26/h9-12,15,20H,13-14H2,1-8H3,(H,27,30)/t20-/m1/s1 |
| InChIKey | LFZPSNZHYDZFBG-HXUWFJFHSA-N |
| XLogP | 6.62 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.56 |
| LogP ≤ 5 | 6.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|