C18H25N3O3 — CID 175242602
tert-butyl N-[[(3S)-1-(2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidin-3-yl]amino]carbamate (PubChem CID 175242602) has the molecular formula C18H25N3O3 and a molecular weight of 331.42 g/mol. Its IUPAC name is tert-butyl N-[[(3S)-1-(2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3S)-1-(2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 175242602 |
| Molecular Formula | C18H25N3O3 |
| Molecular Weight | 331.42 g/mol |
| Exact Mass | 331.19 |
| IUPAC Name | tert-butyl N-[[(3S)-1-(2,3-dihydro-1H-inden-5-yl)-2-oxopyrrolidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@H]1CCN(c2ccc3c(c2)CCC3)C1=O |
| InChI | InChI=1S/C18H25N3O3/c1-18(2,3)24-17(23)20-19-15-9-10-21(16(15)22)14-8-7-12-5-4-6-13(12)11-14/h7-8,11,15,19H,4-6,9-10H2,1-3H3,(H,20,23)/t15-/m0/s1 |
| InChIKey | INJLWFDTCVEZFE-HNNXBMFYSA-N |
| XLogP | 2.31 |
| TPSA | 70.67 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.42 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|