C17H25ClN6O2 — CID 172736754
tert-butyl N-[[(3R)-1-(3-amino-5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]amino]carbamate (PubChem CID 172736754) has the molecular formula C17H25ClN6O2 and a molecular weight of 380.88 g/mol. Its IUPAC name is tert-butyl N-[[(3R)-1-(3-amino-5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]amino]carbamate.
| Compound Name | tert-butyl N-[[(3R)-1-(3-amino-5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]amino]carbamate |
|---|---|
| PubChem CID | 172736754 |
| Molecular Formula | C17H25ClN6O2 |
| Molecular Weight | 380.88 g/mol |
| Exact Mass | 380.17 |
| IUPAC Name | tert-butyl N-[[(3R)-1-(3-amino-5-chloro-1H-pyrrolo[2,3-b]pyridin-4-yl)piperidin-3-yl]amino]carbamate |
| SMILES | CC(C)(C)OC(=O)NN[C@@H]1CCCN(c2c(Cl)cnc3[nH]cc(N)c23)C1 |
| InChI | InChI=1S/C17H25ClN6O2/c1-17(2,3)26-16(25)23-22-10-5-4-6-24(9-10)14-11(18)7-20-15-13(14)12(19)8-21-15/h7-8,10,22H,4-6,9,19H2,1-3H3,(H,20,21)(H,23,25)/t10-/m1/s1 |
| InChIKey | INUNKBJBJQHCLR-SNVBAGLBSA-N |
| XLogP | 2.80 |
| TPSA | 108.30 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.88 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|