C21H32BrN5O3 — CID 67081713
tert-butyl N-[(3R)-1-[5-bromo-3-(3-methoxypropylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate (PubChem CID 67081713) has the molecular formula C21H32BrN5O3 and a molecular weight of 482.42 g/mol. Its IUPAC name is tert-butyl N-[(3R)-1-[5-bromo-3-(3-methoxypropylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3R)-1-[5-bromo-3-(3-methoxypropylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate |
|---|---|
| PubChem CID | 67081713 |
| Molecular Formula | C21H32BrN5O3 |
| Molecular Weight | 482.42 g/mol |
| Exact Mass | 481.17 |
| IUPAC Name | tert-butyl N-[(3R)-1-[5-bromo-3-(3-methoxypropylamino)-1H-pyrrolo[2,3-b]pyridin-4-yl]piperidin-3-yl]carbamate |
| SMILES | COCCCNc1c[nH]c2ncc(Br)c(N3CCC[C@@H](NC(=O)OC(C)(C)C)C3)c12 |
| InChI | InChI=1S/C21H32BrN5O3/c1-21(2,3)30-20(28)26-14-7-5-9-27(13-14)18-15(22)11-24-19-17(18)16(12-25-19)23-8-6-10-29-4/h11-12,14,23H,5-10,13H2,1-4H3,(H,24,25)(H,26,28)/t14-/m1/s1 |
| InChIKey | ZLEDYTSETRDMIA-CQSZACIVSA-N |
| XLogP | 4.27 |
| TPSA | 91.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.42 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|